C18H20BrF2N3OS — CID 139293942
(6R)-6-(3-bromo-2,6-difluorophenyl)-1-[2-[[(3R)-oxolan-3-yl]amino]ethyl]-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione (PubChem CID 139293942) has the molecular formula C18H20BrF2N3OS and a molecular weight of 444.35 g/mol. Its IUPAC name is (6R)-6-(3-bromo-2,6-difluorophenyl)-1-[2-[[(3R)-oxolan-3-yl]amino]ethyl]-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | (6R)-6-(3-bromo-2,6-difluorophenyl)-1-[2-[[(3R)-oxolan-3-yl]amino]ethyl]-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 139293942 |
| Molecular Formula | C18H20BrF2N3OS |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | (6R)-6-(3-bromo-2,6-difluorophenyl)-1-[2-[[(3R)-oxolan-3-yl]amino]ethyl]-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
| SMILES | Fc1ccc(Br)c(F)c1[C@H]1Cc2c(CCN[C@@H]3CCOC3)[nH]c(=S)n2C1 |
| InChI | InChI=1S/C18H20BrF2N3OS/c19-12-1-2-13(20)16(17(12)21)10-7-15-14(23-18(26)24(15)8-10)3-5-22-11-4-6-25-9-11/h1-2,10-11,22H,3-9H2,(H,23,26)/t10-,11+/m0/s1 |
| InChIKey | HVGAQZDHURSVQG-WDEREUQCSA-N |
| XLogP | 3.85 |
| TPSA | 41.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|