C16H17N — CID 142604621
2,9,9-trimethylfluoren-1-amine (PubChem CID 142604621) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is 2,9,9-trimethylfluoren-1-amine.
| Compound Name | 2,9,9-trimethylfluoren-1-amine |
|---|---|
| PubChem CID | 142604621 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2,9,9-trimethylfluoren-1-amine |
| SMILES | Cc1ccc2c(c1N)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C16H17N/c1-10-8-9-12-11-6-4-5-7-13(11)16(2,3)14(12)15(10)17/h4-9H,17H2,1-3H3 |
| InChIKey | WQROOMWIZHNFJK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|