C12H19N — CID 142605610
ethane;N-(6-ethenyl-3-methylcyclohexa-1,5-dien-1-yl)methanimine (PubChem CID 142605610) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is ethane;N-(6-ethenyl-3-methylcyclohexa-1,5-dien-1-yl)methanimine.
| Compound Name | ethane;N-(6-ethenyl-3-methylcyclohexa-1,5-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 142605610 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | ethane;N-(6-ethenyl-3-methylcyclohexa-1,5-dien-1-yl)methanimine |
| SMILES | C=CC1=CCC(C)C=C1N=C.CC |
| InChI | InChI=1S/C10H13N.C2H6/c1-4-9-6-5-8(2)7-10(9)11-3;1-2/h4,6-8H,1,3,5H2,2H3;1-2H3 |
| InChIKey | JGORAGVEQDKYCM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|