C17H24FN — CID 175614207
N-[(3Z,5Z,7Z)-5-[(Z)-but-1-enyl]-3-fluoro-4,6,7-trimethylnona-1,3,5,7-tetraen-2-yl]methanimine (PubChem CID 175614207) has the molecular formula C17H24FN and a molecular weight of 261.38 g/mol. Its IUPAC name is N-[(3Z,5Z,7Z)-5-[(Z)-but-1-enyl]-3-fluoro-4,6,7-trimethylnona-1,3,5,7-tetraen-2-yl]methanimine.
| Compound Name | N-[(3Z,5Z,7Z)-5-[(Z)-but-1-enyl]-3-fluoro-4,6,7-trimethylnona-1,3,5,7-tetraen-2-yl]methanimine |
|---|---|
| PubChem CID | 175614207 |
| Molecular Formula | C17H24FN |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | N-[(3Z,5Z,7Z)-5-[(Z)-but-1-enyl]-3-fluoro-4,6,7-trimethylnona-1,3,5,7-tetraen-2-yl]methanimine |
| SMILES | C=NC(=C)/C(F)=C(C)/C(/C=C\CC)=C(C)\C(C)=C/C |
| InChI | InChI=1S/C17H24FN/c1-8-10-11-16(13(4)12(3)9-2)14(5)17(18)15(6)19-7/h9-11H,6-8H2,1-5H3/b11-10-,12-9-,16-13-,17-14- |
| InChIKey | PTVKFVDIUHJBDV-SOMWBHOFSA-N |
| XLogP | 5.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|