C7H11N3 — CID 142610502
2,4-dimethyl-6-methylidene-1H-pyrimidin-5-amine (PubChem CID 142610502) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 2,4-dimethyl-6-methylidene-1H-pyrimidin-5-amine.
| Compound Name | 2,4-dimethyl-6-methylidene-1H-pyrimidin-5-amine |
|---|---|
| PubChem CID | 142610502 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 2,4-dimethyl-6-methylidene-1H-pyrimidin-5-amine |
| SMILES | C=C1NC(C)=NC(C)=C1N |
| InChI | InChI=1S/C7H11N3/c1-4-7(8)5(2)10-6(3)9-4/h1,8H2,2-3H3,(H,9,10) |
| InChIKey | PGXNJVMXRPVAEA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |