C8H10N2 — CID 142058909
(4E)-2-methyl-5-methylidene-4-prop-2-enylidene-1H-imidazole (PubChem CID 142058909) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is (4E)-2-methyl-5-methylidene-4-prop-2-enylidene-1H-imidazole.
| Compound Name | (4E)-2-methyl-5-methylidene-4-prop-2-enylidene-1H-imidazole |
|---|---|
| PubChem CID | 142058909 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | (4E)-2-methyl-5-methylidene-4-prop-2-enylidene-1H-imidazole |
| SMILES | C=C/C=c1/nc(C)[nH]c1=C |
| InChI | InChI=1S/C8H10N2/c1-4-5-8-6(2)9-7(3)10-8/h4-5H,1-2H2,3H3,(H,9,10)/b8-5+ |
| InChIKey | IODYRHLKTUBEFD-VMPITWQZSA-N |
| XLogP | 0.09 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |