C15H26N4O2 — CID 142610548
2-methyl-N-[N'-methyl-N-[(E)-3-(2-methylbutylideneamino)-4-oxobut-2-en-2-yl]carbamimidoyl]propanamide (PubChem CID 142610548) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-methyl-N-[N'-methyl-N-[(E)-3-(2-methylbutylideneamino)-4-oxobut-2-en-2-yl]carbamimidoyl]propanamide.
| Compound Name | 2-methyl-N-[N'-methyl-N-[(E)-3-(2-methylbutylideneamino)-4-oxobut-2-en-2-yl]carbamimidoyl]propanamide |
|---|---|
| PubChem CID | 142610548 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-methyl-N-[N'-methyl-N-[(E)-3-(2-methylbutylideneamino)-4-oxobut-2-en-2-yl]carbamimidoyl]propanamide |
| SMILES | CCC(C)/C=N/C(C=O)=C(\C)N/C(=N/C)NC(=O)C(C)C |
| InChI | InChI=1S/C15H26N4O2/c1-7-11(4)8-17-13(9-20)12(5)18-15(16-6)19-14(21)10(2)3/h8-11H,7H2,1-6H3,(H2,16,18,19,21)/b13-12+,17-8+ |
| InChIKey | VYIOGUPQEZRIRP-QSARTGRBSA-N |
| XLogP | 1.88 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|