C16H21N3O2 — CID 142610988
1-(oxan-4-yl)-2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9-tetraen-7-yl)ethanol (PubChem CID 142610988) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-(oxan-4-yl)-2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9-tetraen-7-yl)ethanol.
| Compound Name | 1-(oxan-4-yl)-2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9-tetraen-7-yl)ethanol |
|---|---|
| PubChem CID | 142610988 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-(oxan-4-yl)-2-(4,6,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2,4,9-tetraen-7-yl)ethanol |
| SMILES | OC(CC1C2=C(CCC=N2)c2cncn21)C1CCOCC1 |
| InChI | InChI=1S/C16H21N3O2/c20-15(11-3-6-21-7-4-11)8-13-16-12(2-1-5-18-16)14-9-17-10-19(13)14/h5,9-11,13,15,20H,1-4,6-8H2 |
| InChIKey | XFBGSZLCIGKQNQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |