C20H24FN3O4S — CID 142614395
4-[3-[[(2S)-3-(2-cyano-5-methylphenoxy)-2-hydroxypropyl]amino]propyl]-3-fluorobenzenesulfonamide (PubChem CID 142614395) has the molecular formula C20H24FN3O4S and a molecular weight of 421.49 g/mol. Its IUPAC name is 4-[3-[[(2S)-3-(2-cyano-5-methylphenoxy)-2-hydroxypropyl]amino]propyl]-3-fluorobenzenesulfonamide.
| Compound Name | 4-[3-[[(2S)-3-(2-cyano-5-methylphenoxy)-2-hydroxypropyl]amino]propyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 142614395 |
| Molecular Formula | C20H24FN3O4S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 4-[3-[[(2S)-3-(2-cyano-5-methylphenoxy)-2-hydroxypropyl]amino]propyl]-3-fluorobenzenesulfonamide |
| SMILES | Cc1ccc(C#N)c(OC[C@@H](O)CNCCCc2ccc(S(N)(=O)=O)cc2F)c1 |
| InChI | InChI=1S/C20H24FN3O4S/c1-14-4-5-16(11-22)20(9-14)28-13-17(25)12-24-8-2-3-15-6-7-18(10-19(15)21)29(23,26)27/h4-7,9-10,17,24-25H,2-3,8,12-13H2,1H3,(H2,23,26,27)/t17-/m0/s1 |
| InChIKey | NRHBBGCRNSAFAU-KRWDZBQOSA-N |
| XLogP | 1.62 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|