C19H23FN4O6S2 — CID 142614125
1-N-[2-[[(2S)-3-(2-cyano-3-methylphenoxy)-2-hydroxypropyl]amino]ethyl]-2-fluorobenzene-1,4-disulfonamide (PubChem CID 142614125) has the molecular formula C19H23FN4O6S2 and a molecular weight of 486.55 g/mol. Its IUPAC name is 1-N-[2-[[(2S)-3-(2-cyano-3-methylphenoxy)-2-hydroxypropyl]amino]ethyl]-2-fluorobenzene-1,4-disulfonamide.
| Compound Name | 1-N-[2-[[(2S)-3-(2-cyano-3-methylphenoxy)-2-hydroxypropyl]amino]ethyl]-2-fluorobenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 142614125 |
| Molecular Formula | C19H23FN4O6S2 |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 1-N-[2-[[(2S)-3-(2-cyano-3-methylphenoxy)-2-hydroxypropyl]amino]ethyl]-2-fluorobenzene-1,4-disulfonamide |
| SMILES | Cc1cccc(OC[C@@H](O)CNCCNS(=O)(=O)c2ccc(S(N)(=O)=O)cc2F)c1C#N |
| InChI | InChI=1S/C19H23FN4O6S2/c1-13-3-2-4-18(16(13)10-21)30-12-14(25)11-23-7-8-24-32(28,29)19-6-5-15(9-17(19)20)31(22,26)27/h2-6,9,14,23-25H,7-8,11-12H2,1H3,(H2,22,26,27)/t14-/m0/s1 |
| InChIKey | STBVERWIJSAHHY-AWEZNQCLSA-N |
| XLogP | -0.04 |
| TPSA | 171.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|