C17H21ClN4O6S3 — CID 142614179
3-chloro-2-N-[2-[[(2S)-3-(2-cyano-5-methylphenoxy)-2-hydroxypropyl]amino]ethyl]thiophene-2,5-disulfonamide (PubChem CID 142614179) has the molecular formula C17H21ClN4O6S3 and a molecular weight of 509.03 g/mol. Its IUPAC name is 3-chloro-2-N-[2-[[(2S)-3-(2-cyano-5-methylphenoxy)-2-hydroxypropyl]amino]ethyl]thiophene-2,5-disulfonamide.
| Compound Name | 3-chloro-2-N-[2-[[(2S)-3-(2-cyano-5-methylphenoxy)-2-hydroxypropyl]amino]ethyl]thiophene-2,5-disulfonamide |
|---|---|
| PubChem CID | 142614179 |
| Molecular Formula | C17H21ClN4O6S3 |
| Molecular Weight | 509.03 g/mol |
| Exact Mass | 508.03 |
| IUPAC Name | 3-chloro-2-N-[2-[[(2S)-3-(2-cyano-5-methylphenoxy)-2-hydroxypropyl]amino]ethyl]thiophene-2,5-disulfonamide |
| SMILES | Cc1ccc(C#N)c(OC[C@@H](O)CNCCNS(=O)(=O)c2sc(S(N)(=O)=O)cc2Cl)c1 |
| InChI | InChI=1S/C17H21ClN4O6S3/c1-11-2-3-12(8-19)15(6-11)28-10-13(23)9-21-4-5-22-31(26,27)17-14(18)7-16(29-17)30(20,24)25/h2-3,6-7,13,21-23H,4-5,9-10H2,1H3,(H2,20,24,25)/t13-/m0/s1 |
| InChIKey | LHSXUBOHPGRTOZ-ZDUSSCGKSA-N |
| XLogP | 0.54 |
| TPSA | 171.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.03 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|