C46H41N3OS — CID 142615376
1-methyl-4-phenylbenzene;N-[(7-phenyldibenzofuran-1-yl)methyl]methanimine;4-phenyl-3-sulfanylcyclohexa-1,3-diene-1-carboximidamide (PubChem CID 142615376) has the molecular formula C46H41N3OS and a molecular weight of 683.92 g/mol. Its IUPAC name is 1-methyl-4-phenylbenzene;N-[(7-phenyldibenzofuran-1-yl)methyl]methanimine;4-phenyl-3-sulfanylcyclohexa-1,3-diene-1-carboximidamide.
| Compound Name | 1-methyl-4-phenylbenzene;N-[(7-phenyldibenzofuran-1-yl)methyl]methanimine;4-phenyl-3-sulfanylcyclohexa-1,3-diene-1-carboximidamide |
|---|---|
| PubChem CID | 142615376 |
| Molecular Formula | C46H41N3OS |
| Molecular Weight | 683.92 g/mol |
| Exact Mass | 683.30 |
| IUPAC Name | 1-methyl-4-phenylbenzene;N-[(7-phenyldibenzofuran-1-yl)methyl]methanimine;4-phenyl-3-sulfanylcyclohexa-1,3-diene-1-carboximidamide |
| SMILES | C=NCc1cccc2oc3cc(-c4ccccc4)ccc3c12.Cc1ccc(-c2ccccc2)cc1.[H]/N=C(\N)C1=CC(S)=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H15NO.C13H14N2S.C13H12/c1-21-13-16-8-5-9-18-20(16)17-11-10-15(12-19(17)22-18)14-6-3-2-4-7-14;14-13(15)10-6-7-11(12(16)8-10)9-4-2-1-3-5-9;1-11-7-9-13(10-8-11)12-5-3-2-4-6-12/h2-12H,1,13H2;1-5,8,16H,6-7H2,(H3,14,15);2-10H,1H3 |
| InChIKey | OZCSXQDJFDUAAX-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 75.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.92 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|