About ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen
ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen (PubChem CID 142616980) has the molecular formula C10H26N2
and a molecular weight of 174.33 g/mol. Its IUPAC name is ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen |
| PubChem CID | 142616980 |
| Molecular Formula | C10H26N2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.21 |
| IUPAC Name | ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen |
| SMILES | CC.CC(C)N1CC[C@@](C)(N)C1.[H][H] |
| InChI | InChI=1S/C8H18N2.C2H6.H2/c1-7(2)10-5-4-8(3,9)6-10;1-2;/h7H,4-6,9H2,1-3H3;1-2H3;1H/t8-;;/m1../s1 |
| InChIKey | WVAUOYHDHNBDKM-YCBDHFTFSA-N |
| XLogP | 2.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen?
The IUPAC name of ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen (CID 142616980) is ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen.
What is the SMILES notation for ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen?
The canonical SMILES for ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen is CC.CC(C)N1CC[C@@](C)(N)C1.[H][H].
What is the InChIKey of ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen?
The InChIKey is WVAUOYHDHNBDKM-YCBDHFTFSA-N. The full InChI is InChI=1S/C8H18N2.C2H6.H2/c1-7(2)10-5-4-8(3,9)6-10;1-2;/h7H,4-6,9H2,1-3H3;1-2H3;1H/t8-;;/m1../s1.
What are the key properties of ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen?
ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen has a molecular weight of 174.33 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3R)-3-methyl-1-propan-2-ylpyrrolidin-3-amine;molecular hydrogen is sourced from PubChem (CID 142616980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).