C15H22N4O2 — CID 142618725
(Z)-3-amino-2-hydrazinyl-3-(2-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)prop-2-enoic acid (PubChem CID 142618725) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is (Z)-3-amino-2-hydrazinyl-3-(2-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)prop-2-enoic acid.
| Compound Name | (Z)-3-amino-2-hydrazinyl-3-(2-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 142618725 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (Z)-3-amino-2-hydrazinyl-3-(2-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)prop-2-enoic acid |
| SMILES | CC(C)N1CCc2ccc(/C(N)=C(/NN)C(=O)O)cc2C1 |
| InChI | InChI=1S/C15H22N4O2/c1-9(2)19-6-5-10-3-4-11(7-12(10)8-19)13(16)14(18-17)15(20)21/h3-4,7,9,18H,5-6,8,16-17H2,1-2H3,(H,20,21)/b14-13- |
| InChIKey | HTFCDMBEPDEIRB-YPKPFQOOSA-N |
| XLogP | 0.63 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|