C20H23ClN4O3 — CID 142618815
(E)-3-amino-3-[3-chloro-4-(4-piperidin-1-ylphenyl)phenoxy]-2-hydrazinylprop-2-enoic acid (PubChem CID 142618815) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is (E)-3-amino-3-[3-chloro-4-(4-piperidin-1-ylphenyl)phenoxy]-2-hydrazinylprop-2-enoic acid.
| Compound Name | (E)-3-amino-3-[3-chloro-4-(4-piperidin-1-ylphenyl)phenoxy]-2-hydrazinylprop-2-enoic acid |
|---|---|
| PubChem CID | 142618815 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (E)-3-amino-3-[3-chloro-4-(4-piperidin-1-ylphenyl)phenoxy]-2-hydrazinylprop-2-enoic acid |
| SMILES | NN/C(C(=O)O)=C(\N)Oc1ccc(-c2ccc(N3CCCCC3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C20H23ClN4O3/c21-17-12-15(28-19(22)18(24-23)20(26)27)8-9-16(17)13-4-6-14(7-5-13)25-10-2-1-3-11-25/h4-9,12,24H,1-3,10-11,22-23H2,(H,26,27)/b19-18+ |
| InChIKey | BHQBPCUTQCPPEE-VHEBQXMUSA-N |
| XLogP | 3.05 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|