C18H17ClN2O3 — CID 142619023
7-chloro-3-(3,4-dimethoxyphenyl)-2-methoxyquinolin-4-amine (PubChem CID 142619023) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is 7-chloro-3-(3,4-dimethoxyphenyl)-2-methoxyquinolin-4-amine.
| Compound Name | 7-chloro-3-(3,4-dimethoxyphenyl)-2-methoxyquinolin-4-amine |
|---|---|
| PubChem CID | 142619023 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 7-chloro-3-(3,4-dimethoxyphenyl)-2-methoxyquinolin-4-amine |
| SMILES | COc1ccc(-c2c(OC)nc3cc(Cl)ccc3c2N)cc1OC |
| InChI | InChI=1S/C18H17ClN2O3/c1-22-14-7-4-10(8-15(14)23-2)16-17(20)12-6-5-11(19)9-13(12)21-18(16)24-3/h4-9H,1-3H3,(H2,20,21) |
| InChIKey | PEFYOQRCTZUWAX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |