C12H22O4 — CID 142619303
ethane;5-(1-ethoxyethenyl)cyclohex-4-ene-1,2,3-triol (PubChem CID 142619303) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is ethane;5-(1-ethoxyethenyl)cyclohex-4-ene-1,2,3-triol.
| Compound Name | ethane;5-(1-ethoxyethenyl)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 142619303 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | ethane;5-(1-ethoxyethenyl)cyclohex-4-ene-1,2,3-triol |
| SMILES | C=C(OCC)C1=CC(O)C(O)C(O)C1.CC |
| InChI | InChI=1S/C10H16O4.C2H6/c1-3-14-6(2)7-4-8(11)10(13)9(12)5-7;1-2/h4,8-13H,2-3,5H2,1H3;1-2H3 |
| InChIKey | XBYJJWJFWPNDKG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|