C11H14O8 — CID 166957556
(2-acetyloxy-2-oxoethyl) (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate (PubChem CID 166957556) has the molecular formula C11H14O8 and a molecular weight of 274.23 g/mol. Its IUPAC name is (2-acetyloxy-2-oxoethyl) (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate.
| Compound Name | (2-acetyloxy-2-oxoethyl) (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 166957556 |
| Molecular Formula | C11H14O8 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | (2-acetyloxy-2-oxoethyl) (3R,4S,5R)-3,4,5-trihydroxycyclohexene-1-carboxylate |
| SMILES | CC(=O)OC(=O)COC(=O)C1=C[C@@H](O)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C11H14O8/c1-5(12)19-9(15)4-18-11(17)6-2-7(13)10(16)8(14)3-6/h2,7-8,10,13-14,16H,3-4H2,1H3/t7-,8-,10-/m1/s1 |
| InChIKey | CEMDXSUNWLLLFP-NQMVMOMDSA-N |
| XLogP | -1.97 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|