C13H21BN4O2 — CID 142619558
N,N'-diamino-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimidamide (PubChem CID 142619558) has the molecular formula C13H21BN4O2 and a molecular weight of 276.15 g/mol. Its IUPAC name is N,N'-diamino-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimidamide |
|---|---|
| PubChem CID | 142619558 |
| Molecular Formula | C13H21BN4O2 |
| Molecular Weight | 276.15 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N,N'-diamino-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimidamide |
| SMILES | CC1(C)OB(c2cccc(N(N)/C=N\N)c2)OC1(C)C |
| InChI | InChI=1S/C13H21BN4O2/c1-12(2)13(3,4)20-14(19-12)10-6-5-7-11(8-10)18(16)9-17-15/h5-9H,15-16H2,1-4H3/b17-9- |
| InChIKey | NLNGIFFSDUFTAA-MFOYZWKCSA-N |
| XLogP | 0.57 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.15 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|