C40H28N2O — CID 142620428
2-[3,5-bis(4-ethenylphenyl)phenyl]-3-imino-7-phenylbenzo[de]isoquinolin-1-one (PubChem CID 142620428) has the molecular formula C40H28N2O and a molecular weight of 552.68 g/mol. Its IUPAC name is 2-[3,5-bis(4-ethenylphenyl)phenyl]-3-imino-7-phenylbenzo[de]isoquinolin-1-one.
| Compound Name | 2-[3,5-bis(4-ethenylphenyl)phenyl]-3-imino-7-phenylbenzo[de]isoquinolin-1-one |
|---|---|
| PubChem CID | 142620428 |
| Molecular Formula | C40H28N2O |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 2-[3,5-bis(4-ethenylphenyl)phenyl]-3-imino-7-phenylbenzo[de]isoquinolin-1-one |
| SMILES | [H]/N=C1\c2cccc3c(-c4ccccc4)ccc(c23)C(=O)N1c1cc(-c2ccc(C=C)cc2)cc(-c2ccc(C=C)cc2)c1 |
| InChI | InChI=1S/C40H28N2O/c1-3-26-13-17-28(18-14-26)31-23-32(29-19-15-27(4-2)16-20-29)25-33(24-31)42-39(41)36-12-8-11-35-34(30-9-6-5-7-10-30)21-22-37(38(35)36)40(42)43/h3-25,41H,1-2H2/b41-39+ |
| InChIKey | XJZOUPMSUPOVEB-OHYVAXEESA-N |
| XLogP | 10.11 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|