C12H19FN4O2S — CID 142620981
3-fluoro-4-N-(1-methylsulfonylpiperidin-4-yl)benzene-1,2,4-triamine (PubChem CID 142620981) has the molecular formula C12H19FN4O2S and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-fluoro-4-N-(1-methylsulfonylpiperidin-4-yl)benzene-1,2,4-triamine.
| Compound Name | 3-fluoro-4-N-(1-methylsulfonylpiperidin-4-yl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 142620981 |
| Molecular Formula | C12H19FN4O2S |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-fluoro-4-N-(1-methylsulfonylpiperidin-4-yl)benzene-1,2,4-triamine |
| SMILES | CS(=O)(=O)N1CCC(Nc2ccc(N)c(N)c2F)CC1 |
| InChI | InChI=1S/C12H19FN4O2S/c1-20(18,19)17-6-4-8(5-7-17)16-10-3-2-9(14)12(15)11(10)13/h2-3,8,16H,4-7,14-15H2,1H3 |
| InChIKey | XLCBSBJEKILWBQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|