C14H19BrO3S — CID 142625424
2-bromo-4,5-diethyl-3-(2-methoxyethoxy)benzenecarbothioic S-acid (PubChem CID 142625424) has the molecular formula C14H19BrO3S and a molecular weight of 347.27 g/mol. Its IUPAC name is 2-bromo-4,5-diethyl-3-(2-methoxyethoxy)benzenecarbothioic S-acid.
| Compound Name | 2-bromo-4,5-diethyl-3-(2-methoxyethoxy)benzenecarbothioic S-acid |
|---|---|
| PubChem CID | 142625424 |
| Molecular Formula | C14H19BrO3S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 2-bromo-4,5-diethyl-3-(2-methoxyethoxy)benzenecarbothioic S-acid |
| SMILES | CCc1cc(C(=O)S)c(Br)c(OCCOC)c1CC |
| InChI | InChI=1S/C14H19BrO3S/c1-4-9-8-11(14(16)19)12(15)13(10(9)5-2)18-7-6-17-3/h8H,4-7H2,1-3H3,(H,16,19) |
| InChIKey | IQRVXRFMKFOOJN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|