C24H27NO7 — CID 142627207
(2R,3R)-1-(1-carboxy-2-phenylethyl)-3-[4-(4-methoxyphenoxy)butyl]-4-oxoazetidine-2-carboxylic acid (PubChem CID 142627207) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is (2R,3R)-1-(1-carboxy-2-phenylethyl)-3-[4-(4-methoxyphenoxy)butyl]-4-oxoazetidine-2-carboxylic acid.
| Compound Name | (2R,3R)-1-(1-carboxy-2-phenylethyl)-3-[4-(4-methoxyphenoxy)butyl]-4-oxoazetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 142627207 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | (2R,3R)-1-(1-carboxy-2-phenylethyl)-3-[4-(4-methoxyphenoxy)butyl]-4-oxoazetidine-2-carboxylic acid |
| SMILES | COc1ccc(OCCCC[C@H]2C(=O)N(C(Cc3ccccc3)C(=O)O)[C@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C24H27NO7/c1-31-17-10-12-18(13-11-17)32-14-6-5-9-19-21(24(29)30)25(22(19)26)20(23(27)28)15-16-7-3-2-4-8-16/h2-4,7-8,10-13,19-21H,5-6,9,14-15H2,1H3,(H,27,28)(H,29,30)/t19-,20?,21-/m1/s1 |
| InChIKey | VVXLZVMXGHMSBP-GIBKCMNESA-N |
| XLogP | 2.85 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|