C22H26N4O4S — CID 142630198
3-amino-N-[2-[3-[(4-cyanophenyl)methoxymethyl]piperidin-1-yl]-2-oxoethyl]benzenesulfonamide (PubChem CID 142630198) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 3-amino-N-[2-[3-[(4-cyanophenyl)methoxymethyl]piperidin-1-yl]-2-oxoethyl]benzenesulfonamide.
| Compound Name | 3-amino-N-[2-[3-[(4-cyanophenyl)methoxymethyl]piperidin-1-yl]-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 142630198 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-amino-N-[2-[3-[(4-cyanophenyl)methoxymethyl]piperidin-1-yl]-2-oxoethyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(COCC2CCCN(C(=O)CNS(=O)(=O)c3cccc(N)c3)C2)cc1 |
| InChI | InChI=1S/C22H26N4O4S/c23-12-17-6-8-18(9-7-17)15-30-16-19-3-2-10-26(14-19)22(27)13-25-31(28,29)21-5-1-4-20(24)11-21/h1,4-9,11,19,25H,2-3,10,13-16,24H2 |
| InChIKey | FNVCVQUUZRNPOP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|