C29H34O6 — CID 142632161
ethyl 2-[4-[[2-(4-ethoxyphenyl)-2-methylpropoxy]-phenylmethoxy]phenoxy]acetate (PubChem CID 142632161) has the molecular formula C29H34O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is ethyl 2-[4-[[2-(4-ethoxyphenyl)-2-methylpropoxy]-phenylmethoxy]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[[2-(4-ethoxyphenyl)-2-methylpropoxy]-phenylmethoxy]phenoxy]acetate |
|---|---|
| PubChem CID | 142632161 |
| Molecular Formula | C29H34O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | ethyl 2-[4-[[2-(4-ethoxyphenyl)-2-methylpropoxy]-phenylmethoxy]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(OC(OCC(C)(C)c2ccc(OCC)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H34O6/c1-5-31-24-14-12-23(13-15-24)29(3,4)21-34-28(22-10-8-7-9-11-22)35-26-18-16-25(17-19-26)33-20-27(30)32-6-2/h7-19,28H,5-6,20-21H2,1-4H3 |
| InChIKey | MSUKRVTZBINVHF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|