C8H16O5 — CID 142633277
1,1,7-trihydroxy-6-(hydroxymethyl)heptan-4-one (PubChem CID 142633277) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is 1,1,7-trihydroxy-6-(hydroxymethyl)heptan-4-one.
| Compound Name | 1,1,7-trihydroxy-6-(hydroxymethyl)heptan-4-one |
|---|---|
| PubChem CID | 142633277 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 1,1,7-trihydroxy-6-(hydroxymethyl)heptan-4-one |
| SMILES | O=C(CCC(O)O)CC(CO)CO |
| InChI | InChI=1S/C8H16O5/c9-4-6(5-10)3-7(11)1-2-8(12)13/h6,8-10,12-13H,1-5H2 |
| InChIKey | GHKAPRXDMMMXRY-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|