C7H15NO3 — CID 147622827
(5S)-5,6-dihydroxy-1-(methylamino)hexan-2-one (PubChem CID 147622827) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is (5S)-5,6-dihydroxy-1-(methylamino)hexan-2-one.
| Compound Name | (5S)-5,6-dihydroxy-1-(methylamino)hexan-2-one |
|---|---|
| PubChem CID | 147622827 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | (5S)-5,6-dihydroxy-1-(methylamino)hexan-2-one |
| SMILES | CNCC(=O)CC[C@H](O)CO |
| InChI | InChI=1S/C7H15NO3/c1-8-4-6(10)2-3-7(11)5-9/h7-9,11H,2-5H2,1H3/t7-/m0/s1 |
| InChIKey | GEEZYCLVQHAVKI-ZETCQYMHSA-N |
| XLogP | -1.09 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |