C8H16O4 — CID 174715616
3,7,8-trihydroxyoctan-4-one (PubChem CID 174715616) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is 3,7,8-trihydroxyoctan-4-one.
| Compound Name | 3,7,8-trihydroxyoctan-4-one |
|---|---|
| PubChem CID | 174715616 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 3,7,8-trihydroxyoctan-4-one |
| SMILES | CCC(O)C(=O)CCC(O)CO |
| InChI | InChI=1S/C8H16O4/c1-2-7(11)8(12)4-3-6(10)5-9/h6-7,9-11H,2-5H2,1H3 |
| InChIKey | PBZPFQUYNCHGBD-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |