C22H29NO5S — CID 142636494
[1-(4-hydroxy-3-methylphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)propyl] methanesulfonate (PubChem CID 142636494) has the molecular formula C22H29NO5S and a molecular weight of 419.54 g/mol. Its IUPAC name is [1-(4-hydroxy-3-methylphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)propyl] methanesulfonate.
| Compound Name | [1-(4-hydroxy-3-methylphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)propyl] methanesulfonate |
|---|---|
| PubChem CID | 142636494 |
| Molecular Formula | C22H29NO5S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | [1-(4-hydroxy-3-methylphenyl)-2-(4-hydroxy-4-phenylpiperidin-1-yl)propyl] methanesulfonate |
| SMILES | Cc1cc(C(OS(C)(=O)=O)C(C)N2CCC(O)(c3ccccc3)CC2)ccc1O |
| InChI | InChI=1S/C22H29NO5S/c1-16-15-18(9-10-20(16)24)21(28-29(3,26)27)17(2)23-13-11-22(25,12-14-23)19-7-5-4-6-8-19/h4-10,15,17,21,24-25H,11-14H2,1-3H3 |
| InChIKey | GURQDSZLDCPAIY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|