C21H31N3O6 — CID 142638161
benzyl (2R,3S)-3-amino-2-(butoxycarbonylamino)-2-(2-ethoxy-2-oxoethyl)pyrrolidine-1-carboxylate (PubChem CID 142638161) has the molecular formula C21H31N3O6 and a molecular weight of 421.49 g/mol. Its IUPAC name is benzyl (2R,3S)-3-amino-2-(butoxycarbonylamino)-2-(2-ethoxy-2-oxoethyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3S)-3-amino-2-(butoxycarbonylamino)-2-(2-ethoxy-2-oxoethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142638161 |
| Molecular Formula | C21H31N3O6 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | benzyl (2R,3S)-3-amino-2-(butoxycarbonylamino)-2-(2-ethoxy-2-oxoethyl)pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N[C@@]1(CC(=O)OCC)[C@@H](N)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H31N3O6/c1-3-5-13-29-19(26)23-21(14-18(25)28-4-2)17(22)11-12-24(21)20(27)30-15-16-9-7-6-8-10-16/h6-10,17H,3-5,11-15,22H2,1-2H3,(H,23,26)/t17-,21+/m0/s1 |
| InChIKey | YZIRJLGEKKABIT-LAUBAEHRSA-N |
| XLogP | 2.53 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|