C26H24O4S2 — CID 142639311
3-(4-butoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one (PubChem CID 142639311) has the molecular formula C26H24O4S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one.
| Compound Name | 3-(4-butoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one |
|---|---|
| PubChem CID | 142639311 |
| Molecular Formula | C26H24O4S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 3-(4-butoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one |
| SMILES | CCCCOc1ccc(-c2c(-c3ccc(S(C)(=O)=O)cc3)sc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C26H24O4S2/c1-3-4-17-30-20-13-9-18(10-14-20)24-25(27)22-7-5-6-8-23(22)31-26(24)19-11-15-21(16-12-19)32(2,28)29/h5-16H,3-4,17H2,1-2H3 |
| InChIKey | SZWYQJMRORPYDQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|