C24H20O3S2 — CID 142639276
3-(4-ethylphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one (PubChem CID 142639276) has the molecular formula C24H20O3S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one.
| Compound Name | 3-(4-ethylphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one |
|---|---|
| PubChem CID | 142639276 |
| Molecular Formula | C24H20O3S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 3-(4-ethylphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one |
| SMILES | CCc1ccc(-c2c(-c3ccc(S(C)(=O)=O)cc3)sc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C24H20O3S2/c1-3-16-8-10-17(11-9-16)22-23(25)20-6-4-5-7-21(20)28-24(22)18-12-14-19(15-13-18)29(2,26)27/h4-15H,3H2,1-2H3 |
| InChIKey | KGCWXGNCDDWYNX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |