C23H19NO3S2 — CID 142639581
4-[3-(4-ethylphenyl)-4-oxothiochromen-2-yl]benzenesulfonamide (PubChem CID 142639581) has the molecular formula C23H19NO3S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is 4-[3-(4-ethylphenyl)-4-oxothiochromen-2-yl]benzenesulfonamide.
| Compound Name | 4-[3-(4-ethylphenyl)-4-oxothiochromen-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 142639581 |
| Molecular Formula | C23H19NO3S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 4-[3-(4-ethylphenyl)-4-oxothiochromen-2-yl]benzenesulfonamide |
| SMILES | CCc1ccc(-c2c(-c3ccc(S(N)(=O)=O)cc3)sc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C23H19NO3S2/c1-2-15-7-9-16(10-8-15)21-22(25)19-5-3-4-6-20(19)28-23(21)17-11-13-18(14-12-17)29(24,26)27/h3-14H,2H2,1H3,(H2,24,26,27) |
| InChIKey | DAAFTAQXLOZBKT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |