C21H16N2O3S2 — CID 142639324
4-[3-(6-methyl-3-pyridinyl)-4-oxothiochromen-2-yl]benzenesulfonamide (PubChem CID 142639324) has the molecular formula C21H16N2O3S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-[3-(6-methyl-3-pyridinyl)-4-oxothiochromen-2-yl]benzenesulfonamide.
| Compound Name | 4-[3-(6-methyl-3-pyridinyl)-4-oxothiochromen-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 142639324 |
| Molecular Formula | C21H16N2O3S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 4-[3-(6-methyl-3-pyridinyl)-4-oxothiochromen-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2c(-c3ccc(S(N)(=O)=O)cc3)sc3ccccc3c2=O)cn1 |
| InChI | InChI=1S/C21H16N2O3S2/c1-13-6-7-15(12-23-13)19-20(24)17-4-2-3-5-18(17)27-21(19)14-8-10-16(11-9-14)28(22,25)26/h2-12H,1H3,(H2,22,25,26) |
| InChIKey | HQOAMTVMQQFFCI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |