C23H15NO4S2 — CID 142639198
4-[3-(1-benzofuran-2-yl)-4-oxothiochromen-2-yl]benzenesulfonamide (PubChem CID 142639198) has the molecular formula C23H15NO4S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-[3-(1-benzofuran-2-yl)-4-oxothiochromen-2-yl]benzenesulfonamide.
| Compound Name | 4-[3-(1-benzofuran-2-yl)-4-oxothiochromen-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 142639198 |
| Molecular Formula | C23H15NO4S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | 4-[3-(1-benzofuran-2-yl)-4-oxothiochromen-2-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2sc3ccccc3c(=O)c2-c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C23H15NO4S2/c24-30(26,27)16-11-9-14(10-12-16)23-21(19-13-15-5-1-3-7-18(15)28-19)22(25)17-6-2-4-8-20(17)29-23/h1-13H,(H2,24,26,27) |
| InChIKey | SDSSOYFSCRUHJU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |