C24H20O5S2 — CID 142639417
3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one (PubChem CID 142639417) has the molecular formula C24H20O5S2 and a molecular weight of 452.55 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one |
|---|---|
| PubChem CID | 142639417 |
| Molecular Formula | C24H20O5S2 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one |
| SMILES | COc1ccc(-c2c(-c3ccc(S(C)(=O)=O)cc3)sc3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C24H20O5S2/c1-28-19-13-10-16(14-20(19)29-2)22-23(25)18-6-4-5-7-21(18)30-24(22)15-8-11-17(12-9-15)31(3,26)27/h4-14H,1-3H3 |
| InChIKey | NGXXWEHUGOLXBK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |