About 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one
3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one (PubChem CID 142639417) has the molecular formula C24H20O5S2
and a molecular weight of 452.55 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one.
Molecular Properties
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one |
| PubChem CID | 142639417 |
| Molecular Formula | C24H20O5S2 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one |
| SMILES | COc1ccc(-c2c(-c3ccc(S(C)(=O)=O)cc3)sc3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C24H20O5S2/c1-28-19-13-10-16(14-20(19)29-2)22-23(25)18-6-4-5-7-21(18)30-24(22)15-8-11-17(12-9-15)31(3,26)27/h4-14H,1-3H3 |
| InChIKey | NGXXWEHUGOLXBK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one?
The IUPAC name of 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one (CID 142639417) is 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one.
What is the SMILES notation for 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one?
The canonical SMILES for 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one is COc1ccc(-c2c(-c3ccc(S(C)(=O)=O)cc3)sc3ccccc3c2=O)cc1OC.
What is the InChIKey of 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one?
The InChIKey is NGXXWEHUGOLXBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20O5S2/c1-28-19-13-10-16(14-20(19)29-2)22-23(25)18-6-4-5-7-21(18)30-24(22)15-8-11-17(12-9-15)31(3,26)27/h4-14H,1-3H3.
What are the key properties of 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one?
3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one has a molecular weight of 452.55 g/mol, XLogP of 5.02, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethoxyphenyl)-2-(4-methylsulfonylphenyl)thiochromen-4-one is sourced from PubChem (CID 142639417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).