C28H40Br2FN3O3 — CID 142643766
(1R,3S)-1-(aminomethyl)-3-[1-[2-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol;dihydrobromide (PubChem CID 142643766) has the molecular formula C28H40Br2FN3O3 and a molecular weight of 645.45 g/mol. Its IUPAC name is (1R,3S)-1-(aminomethyl)-3-[1-[2-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol;dihydrobromide.
| Compound Name | (1R,3S)-1-(aminomethyl)-3-[1-[2-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol;dihydrobromide |
|---|---|
| PubChem CID | 142643766 |
| Molecular Formula | C28H40Br2FN3O3 |
| Molecular Weight | 645.45 g/mol |
| Exact Mass | 643.14 |
| IUPAC Name | (1R,3S)-1-(aminomethyl)-3-[1-[2-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]piperidin-4-yl]-3,4-dihydro-1H-isochromene-5,6-diol;dihydrobromide |
| SMILES | Br.Br.NC[C@@H]1O[C@H](C2CCN(C3CCNC(CCc4ccc(F)cc4)C3)CC2)Cc2c1ccc(O)c2O |
| InChI | InChI=1S/C28H38FN3O3.2BrH/c29-20-4-1-18(2-5-20)3-6-21-15-22(9-12-31-21)32-13-10-19(11-14-32)26-16-24-23(27(17-30)35-26)7-8-25(33)28(24)34;;/h1-2,4-5,7-8,19,21-22,26-27,31,33-34H,3,6,9-17,30H2;2*1H/t21?,22?,26-,27-;;/m0../s1 |
| InChIKey | DURODCVXBGBGBG-JDGCEAFBSA-N |
| XLogP | 4.80 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|