About 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate
2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate (PubChem CID 142643859) has the molecular formula C14H23N3O5S
and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate.
Molecular Properties
| Compound Name | 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate |
| PubChem CID | 142643859 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate |
| SMILES | O.O.O.O.c1csc(CNCCOc2cccc3[nH]cnc23)c1 |
| InChI | InChI=1S/C14H15N3OS.4H2O/c1-4-12-14(17-10-16-12)13(5-1)18-7-6-15-9-11-3-2-8-19-11;;;;/h1-5,8,10,15H,6-7,9H2,(H,16,17);4*1H2 |
| InChIKey | LOCHCKWTKORXEQ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 175.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate?
The IUPAC name of 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate (CID 142643859) is 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate.
What is the SMILES notation for 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate?
The canonical SMILES for 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate is O.O.O.O.c1csc(CNCCOc2cccc3[nH]cnc23)c1.
What is the InChIKey of 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate?
The InChIKey is LOCHCKWTKORXEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3OS.4H2O/c1-4-12-14(17-10-16-12)13(5-1)18-7-6-15-9-11-3-2-8-19-11;;;;/h1-5,8,10,15H,6-7,9H2,(H,16,17);4*1H2.
What are the key properties of 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate?
2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate has a molecular weight of 345.42 g/mol, XLogP of -0.51, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate is sourced from PubChem (CID 142643859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).