C14H23N3O5S — CID 142643859
2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate (PubChem CID 142643859) has the molecular formula C14H23N3O5S and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate.
| Compound Name | 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate |
|---|---|
| PubChem CID | 142643859 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;tetrahydrate |
| SMILES | O.O.O.O.c1csc(CNCCOc2cccc3[nH]cnc23)c1 |
| InChI | InChI=1S/C14H15N3OS.4H2O/c1-4-12-14(17-10-16-12)13(5-1)18-7-6-15-9-11-3-2-8-19-11;;;;/h1-5,8,10,15H,6-7,9H2,(H,16,17);4*1H2 |
| InChIKey | LOCHCKWTKORXEQ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 175.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|