C14H17Cl2N3OS — CID 23291473
2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;dihydrochloride (PubChem CID 23291473) has the molecular formula C14H17Cl2N3OS and a molecular weight of 346.28 g/mol. Its IUPAC name is 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;dihydrochloride.
| Compound Name | 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 23291473 |
| Molecular Formula | C14H17Cl2N3OS |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 2-(1H-benzimidazol-4-yloxy)-N-(thiophen-2-ylmethyl)ethanamine;dihydrochloride |
| SMILES | Cl.Cl.c1csc(CNCCOc2cccc3[nH]cnc23)c1 |
| InChI | InChI=1S/C14H15N3OS.2ClH/c1-4-12-14(17-10-16-12)13(5-1)18-7-6-15-9-11-3-2-8-19-11;;/h1-5,8,10,15H,6-7,9H2,(H,16,17);2*1H |
| InChIKey | TUHWAKRSZQFGDU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|