C21H28N2O3 — CID 142644320
(3R,5R)-3-butyl-3-ethyl-4-hydroxy-5-phenyl-2,5-dihydro-1H-1,4-benzodiazepine-7,8-diol (PubChem CID 142644320) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is (3R,5R)-3-butyl-3-ethyl-4-hydroxy-5-phenyl-2,5-dihydro-1H-1,4-benzodiazepine-7,8-diol.
| Compound Name | (3R,5R)-3-butyl-3-ethyl-4-hydroxy-5-phenyl-2,5-dihydro-1H-1,4-benzodiazepine-7,8-diol |
|---|---|
| PubChem CID | 142644320 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (3R,5R)-3-butyl-3-ethyl-4-hydroxy-5-phenyl-2,5-dihydro-1H-1,4-benzodiazepine-7,8-diol |
| SMILES | CCCC[C@]1(CC)CNc2cc(O)c(O)cc2[C@@H](c2ccccc2)N1O |
| InChI | InChI=1S/C21H28N2O3/c1-3-5-11-21(4-2)14-22-17-13-19(25)18(24)12-16(17)20(23(21)26)15-9-7-6-8-10-15/h6-10,12-13,20,22,24-26H,3-5,11,14H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | WYQAZPSCRQOZCI-NHCUHLMSSA-N |
| XLogP | 4.64 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|