C23H30BrNO2S — CID 67466592
(3R,5R)-8-(bromomethyl)-3-butyl-3-ethyl-4-hydroxy-7-methoxy-5-phenyl-2,5-dihydro-1,4-benzothiazepine (PubChem CID 67466592) has the molecular formula C23H30BrNO2S and a molecular weight of 464.47 g/mol. Its IUPAC name is (3R,5R)-8-(bromomethyl)-3-butyl-3-ethyl-4-hydroxy-7-methoxy-5-phenyl-2,5-dihydro-1,4-benzothiazepine.
| Compound Name | (3R,5R)-8-(bromomethyl)-3-butyl-3-ethyl-4-hydroxy-7-methoxy-5-phenyl-2,5-dihydro-1,4-benzothiazepine |
|---|---|
| PubChem CID | 67466592 |
| Molecular Formula | C23H30BrNO2S |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | (3R,5R)-8-(bromomethyl)-3-butyl-3-ethyl-4-hydroxy-7-methoxy-5-phenyl-2,5-dihydro-1,4-benzothiazepine |
| SMILES | CCCC[C@]1(CC)CSc2cc(CBr)c(OC)cc2[C@@H](c2ccccc2)N1O |
| InChI | InChI=1S/C23H30BrNO2S/c1-4-6-12-23(5-2)16-28-21-13-18(15-24)20(27-3)14-19(21)22(25(23)26)17-10-8-7-9-11-17/h7-11,13-14,22,26H,4-6,12,15-16H2,1-3H3/t22-,23-/m1/s1 |
| InChIKey | ZVFZESQENHKDOG-DHIUTWEWSA-N |
| XLogP | 6.82 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|