C27H40N2O5S — CID 67465956
4-[[(3R,5R)-3-butyl-3-ethyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl]methylamino]butanoic acid (PubChem CID 67465956) has the molecular formula C27H40N2O5S and a molecular weight of 504.69 g/mol. Its IUPAC name is 4-[[(3R,5R)-3-butyl-3-ethyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl]methylamino]butanoic acid.
| Compound Name | 4-[[(3R,5R)-3-butyl-3-ethyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 67465956 |
| Molecular Formula | C27H40N2O5S |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 4-[[(3R,5R)-3-butyl-3-ethyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl]methylamino]butanoic acid |
| SMILES | CCCC[C@]1(CC)CS(O)(O)c2cc(CNCCCC(=O)O)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C27H40N2O5S/c1-4-6-14-27(5-2)19-35(32,33)24-16-21(18-28-15-10-13-25(30)31)23(34-3)17-22(24)26(29-27)20-11-8-7-9-12-20/h7-9,11-12,16-17,26,28-29,32-33H,4-6,10,13-15,18-19H2,1-3H3,(H,30,31)/t26-,27-/m1/s1 |
| InChIKey | IJYZOILVLHVEEJ-KAYWLYCHSA-N |
| XLogP | 5.79 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|