C32H43F3N2O8S — CID 89396407
3-[(3,3-dibutyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl)methylamino]-5-oxo-5-(2,2,2-trifluoroacetyl)oxypentanoic acid (PubChem CID 89396407) has the molecular formula C32H43F3N2O8S and a molecular weight of 672.76 g/mol. Its IUPAC name is 3-[(3,3-dibutyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl)methylamino]-5-oxo-5-(2,2,2-trifluoroacetyl)oxypentanoic acid.
| Compound Name | 3-[(3,3-dibutyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl)methylamino]-5-oxo-5-(2,2,2-trifluoroacetyl)oxypentanoic acid |
|---|---|
| PubChem CID | 89396407 |
| Molecular Formula | C32H43F3N2O8S |
| Molecular Weight | 672.76 g/mol |
| Exact Mass | 672.27 |
| IUPAC Name | 3-[(3,3-dibutyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl)methylamino]-5-oxo-5-(2,2,2-trifluoroacetyl)oxypentanoic acid |
| SMILES | CCCCC1(CCCC)CS(O)(O)c2cc(CNC(CC(=O)O)CC(=O)OC(=O)C(F)(F)F)c(OC)cc2C(c2ccccc2)N1 |
| InChI | InChI=1S/C32H43F3N2O8S/c1-4-6-13-31(14-7-5-2)20-46(42,43)26-15-22(25(44-3)18-24(26)29(37-31)21-11-9-8-10-12-21)19-36-23(16-27(38)39)17-28(40)45-30(41)32(33,34)35/h8-12,15,18,23,29,36-37,42-43H,4-7,13-14,16-17,19-20H2,1-3H3,(H,38,39) |
| InChIKey | KDLZPJWIYICBIH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.76 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|