C26H42N4O6S — CID 71734594
azane;(2S)-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]-3-hydroxypropanoic acid (PubChem CID 71734594) has the molecular formula C26H42N4O6S and a molecular weight of 538.71 g/mol. Its IUPAC name is azane;(2S)-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]-3-hydroxypropanoic acid.
| Compound Name | azane;(2S)-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 71734594 |
| Molecular Formula | C26H42N4O6S |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | azane;(2S)-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]-3-hydroxypropanoic acid |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(CN[C@@H](CO)C(=O)O)c(OC)cc2[C@@H](c2ccccc2)N1.N.N |
| InChI | InChI=1S/C26H36N2O6S.2H3N/c1-4-6-12-26(5-2)17-35(32,33)23-13-19(15-27-21(16-29)25(30)31)22(34-3)14-20(23)24(28-26)18-10-8-7-9-11-18;;/h7-11,13-14,21,24,27-29H,4-6,12,15-17H2,1-3H3,(H,30,31);2*1H3/t21-,24+,26+;;/m0../s1 |
| InChIKey | HLUQHCOPQHNKQL-MNCHEZEGSA-N |
| XLogP | 3.36 |
| TPSA | 194.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |