C30H43N3O7S3 — CID 121381086
(2R)-3-[[(2R)-2-amino-3-methoxy-3-oxopropyl]disulfanyl]-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]propanoic acid (PubChem CID 121381086) has the molecular formula C30H43N3O7S3 and a molecular weight of 653.89 g/mol. Its IUPAC name is (2R)-3-[[(2R)-2-amino-3-methoxy-3-oxopropyl]disulfanyl]-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]propanoic acid.
| Compound Name | (2R)-3-[[(2R)-2-amino-3-methoxy-3-oxopropyl]disulfanyl]-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 121381086 |
| Molecular Formula | C30H43N3O7S3 |
| Molecular Weight | 653.89 g/mol |
| Exact Mass | 653.23 |
| IUPAC Name | (2R)-3-[[(2R)-2-amino-3-methoxy-3-oxopropyl]disulfanyl]-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]propanoic acid |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(CN[C@@H](CSSC[C@H](N)C(=O)OC)C(=O)O)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C30H43N3O7S3/c1-5-7-13-30(6-2)19-43(37,38)26-14-21(16-32-24(28(34)35)18-42-41-17-23(31)29(36)40-4)25(39-3)15-22(26)27(33-30)20-11-9-8-10-12-20/h8-12,14-15,23-24,27,32-33H,5-7,13,16-19,31H2,1-4H3,(H,34,35)/t23-,24-,27+,30+/m0/s1 |
| InChIKey | GUGLDEVXKYYNHA-BMOHHQGPSA-N |
| XLogP | 3.92 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.89 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|