C25H36N2O3S — CID 170541304
(3R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-8-[(propan-2-ylamino)methyl]-4,5-dihydro-2H-1λ6,4-benzothiazepin-7-ol (PubChem CID 170541304) has the molecular formula C25H36N2O3S and a molecular weight of 444.64 g/mol. Its IUPAC name is (3R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-8-[(propan-2-ylamino)methyl]-4,5-dihydro-2H-1λ6,4-benzothiazepin-7-ol.
| Compound Name | (3R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-8-[(propan-2-ylamino)methyl]-4,5-dihydro-2H-1λ6,4-benzothiazepin-7-ol |
|---|---|
| PubChem CID | 170541304 |
| Molecular Formula | C25H36N2O3S |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | (3R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-8-[(propan-2-ylamino)methyl]-4,5-dihydro-2H-1λ6,4-benzothiazepin-7-ol |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(CNC(C)C)c(O)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C25H36N2O3S/c1-5-7-13-25(6-2)17-31(29,30)23-14-20(16-26-18(3)4)22(28)15-21(23)24(27-25)19-11-9-8-10-12-19/h8-12,14-15,18,24,26-28H,5-7,13,16-17H2,1-4H3/t24-,25-/m1/s1 |
| InChIKey | AOUPNHDMGKGRHL-JWQCQUIFSA-N |
| XLogP | 4.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|