C21H27NO2S2 — CID 58529144
(3R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine-8-thiol (PubChem CID 58529144) has the molecular formula C21H27NO2S2 and a molecular weight of 389.59 g/mol. Its IUPAC name is (3R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine-8-thiol.
| Compound Name | (3R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine-8-thiol |
|---|---|
| PubChem CID | 58529144 |
| Molecular Formula | C21H27NO2S2 |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (3R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine-8-thiol |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(S)ccc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C21H27NO2S2/c1-3-5-13-21(4-2)15-26(23,24)19-14-17(25)11-12-18(19)20(22-21)16-9-7-6-8-10-16/h6-12,14,20,22,25H,3-5,13,15H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | WFABACJUGBIZIS-NHCUHLMSSA-N |
| XLogP | 4.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|