C21H27NO6S2 — CID 67425549
(3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl) hydrogen sulfate (PubChem CID 67425549) has the molecular formula C21H27NO6S2 and a molecular weight of 453.58 g/mol. Its IUPAC name is (3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl) hydrogen sulfate.
| Compound Name | (3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 67425549 |
| Molecular Formula | C21H27NO6S2 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | (3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl) hydrogen sulfate |
| SMILES | CCCCC1(CC)CS(=O)(=O)c2cc(OS(=O)(=O)O)ccc2C(c2ccccc2)N1 |
| InChI | InChI=1S/C21H27NO6S2/c1-3-5-13-21(4-2)15-29(23,24)19-14-17(28-30(25,26)27)11-12-18(19)20(22-21)16-9-7-6-8-10-16/h6-12,14,20,22H,3-5,13,15H2,1-2H3,(H,25,26,27) |
| InChIKey | JMWIWUCBYJNVDC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|