C26H37NO6S2 — CID 71734125
3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propyl methanesulfonate (PubChem CID 71734125) has the molecular formula C26H37NO6S2 and a molecular weight of 523.72 g/mol. Its IUPAC name is 3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propyl methanesulfonate.
| Compound Name | 3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propyl methanesulfonate |
|---|---|
| PubChem CID | 71734125 |
| Molecular Formula | C26H37NO6S2 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propyl methanesulfonate |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(CCCOS(C)(=O)=O)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C26H37NO6S2/c1-5-7-15-26(6-2)19-35(30,31)24-17-21(14-11-16-33-34(4,28)29)23(32-3)18-22(24)25(27-26)20-12-9-8-10-13-20/h8-10,12-13,17-18,25,27H,5-7,11,14-16,19H2,1-4H3/t25-,26-/m1/s1 |
| InChIKey | DCFLMHOOIZCSCK-CLJLJLNGSA-N |
| XLogP | 4.41 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|