C27H37F3NO8PS — CID 71237628
(3,3-dibutyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl)methylphosphonic acid;2,2,2-trifluoroacetic acid (PubChem CID 71237628) has the molecular formula C27H37F3NO8PS and a molecular weight of 623.63 g/mol. Its IUPAC name is (3,3-dibutyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl)methylphosphonic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (3,3-dibutyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl)methylphosphonic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71237628 |
| Molecular Formula | C27H37F3NO8PS |
| Molecular Weight | 623.63 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | (3,3-dibutyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl)methylphosphonic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCCC1(CCCC)CS(=O)(=O)c2cc(CP(=O)(O)O)c(OC)cc2C(c2ccccc2)N1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H36NO6PS.C2HF3O2/c1-4-6-13-25(14-7-5-2)18-34(30,31)23-15-20(17-33(27,28)29)22(32-3)16-21(23)24(26-25)19-11-9-8-10-12-19;3-2(4,5)1(6)7/h8-12,15-16,24,26H,4-7,13-14,17-18H2,1-3H3,(H2,27,28,29);(H,6,7) |
| InChIKey | HXIKKZHNPRYUOQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|